About S-(1-phenylethyl) 2-oxopropanethioate
S-(1-phenylethyl) 2-oxopropanethioate (PubChem CID 88562962) has the molecular formula C11H12O2S
and a molecular weight of 208.28 g/mol. Its IUPAC name is S-(1-phenylethyl) 2-oxopropanethioate.
Molecular Properties
| Compound Name | S-(1-phenylethyl) 2-oxopropanethioate |
| PubChem CID | 88562962 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | S-(1-phenylethyl) 2-oxopropanethioate |
| SMILES | CC(=O)C(=O)SC(C)c1ccccc1 |
| InChI | InChI=1S/C11H12O2S/c1-8(12)11(13)14-9(2)10-6-4-3-5-7-10/h3-7,9H,1-2H3 |
| InChIKey | OOXDTUBUVBFTOW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(1-phenylethyl) 2-oxopropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(1-phenylethyl) 2-oxopropanethioate?
The IUPAC name of S-(1-phenylethyl) 2-oxopropanethioate (CID 88562962) is S-(1-phenylethyl) 2-oxopropanethioate.
What is the SMILES notation for S-(1-phenylethyl) 2-oxopropanethioate?
The canonical SMILES for S-(1-phenylethyl) 2-oxopropanethioate is CC(=O)C(=O)SC(C)c1ccccc1.
What is the InChIKey of S-(1-phenylethyl) 2-oxopropanethioate?
The InChIKey is OOXDTUBUVBFTOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2S/c1-8(12)11(13)14-9(2)10-6-4-3-5-7-10/h3-7,9H,1-2H3.
What are the key properties of S-(1-phenylethyl) 2-oxopropanethioate?
S-(1-phenylethyl) 2-oxopropanethioate has a molecular weight of 208.28 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(1-phenylethyl) 2-oxopropanethioate is sourced from PubChem (CID 88562962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).