C18H30N2OS2 — CID 8818642
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 8818642) has the molecular formula C18H30N2OS2 and a molecular weight of 354.59 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818642 |
| Molecular Formula | C18H30N2OS2 |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[C@H](C)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H30N2OS2/c1-4-20(5-2)17(22)23-12(3)16(21)19-18-9-13-6-14(10-18)8-15(7-13)11-18/h12-15H,4-11H2,1-3H3,(H,19,21)/t12-,13?,14?,15?,18?/m1/s1 |
| InChIKey | QBJGMAJPLPVTCK-QLFDAEIZSA-N |
| XLogP | 3.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|