C7H13N3OS — CID 65212338
[1-(cyclopropylamino)-1-oxopropan-2-yl] carbamimidothioate (PubChem CID 65212338) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is [1-(cyclopropylamino)-1-oxopropan-2-yl] carbamimidothioate.
| Compound Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] carbamimidothioate |
|---|---|
| PubChem CID | 65212338 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SC(C)C(=O)NC1CC1 |
| InChI | InChI=1S/C7H13N3OS/c1-4(12-7(8)9)6(11)10-5-2-3-5/h4-5H,2-3H2,1H3,(H3,8,9)(H,10,11) |
| InChIKey | SNVRWOBIAZWTKS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|