C11H22N2OS — CID 66219669
2-(2-aminopropylsulfanyl)-N-cyclopentylpropanamide (PubChem CID 66219669) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 2-(2-aminopropylsulfanyl)-N-cyclopentylpropanamide.
| Compound Name | 2-(2-aminopropylsulfanyl)-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 66219669 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-(2-aminopropylsulfanyl)-N-cyclopentylpropanamide |
| SMILES | CC(N)CSC(C)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C11H22N2OS/c1-8(12)7-15-9(2)11(14)13-10-5-3-4-6-10/h8-10H,3-7,12H2,1-2H3,(H,13,14) |
| InChIKey | CTSXKZQRLPNTTP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |