C15H20FNOS — CID 95579029
(2S)-N-cyclopentyl-2-[(2-fluorophenyl)methylsulfanyl]propanamide (PubChem CID 95579029) has the molecular formula C15H20FNOS and a molecular weight of 281.40 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-2-[(2-fluorophenyl)methylsulfanyl]propanamide.
| Compound Name | (2S)-N-cyclopentyl-2-[(2-fluorophenyl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 95579029 |
| Molecular Formula | C15H20FNOS |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (2S)-N-cyclopentyl-2-[(2-fluorophenyl)methylsulfanyl]propanamide |
| SMILES | C[C@H](SCc1ccccc1F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H20FNOS/c1-11(15(18)17-13-7-3-4-8-13)19-10-12-6-2-5-9-14(12)16/h2,5-6,9,11,13H,3-4,7-8,10H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | TTYWGZKVPHRFCJ-NSHDSACASA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |