C10H11FO2S — CID 24706071
2-[(2-fluorophenyl)methylsulfanyl]propanoic acid (PubChem CID 24706071) has the molecular formula C10H11FO2S and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methylsulfanyl]propanoic acid.
| Compound Name | 2-[(2-fluorophenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 24706071 |
| Molecular Formula | C10H11FO2S |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-[(2-fluorophenyl)methylsulfanyl]propanoic acid |
| SMILES | CC(SCc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C10H11FO2S/c1-7(10(12)13)14-6-8-4-2-3-5-9(8)11/h2-5,7H,6H2,1H3,(H,12,13) |
| InChIKey | JQNXCBZLKICCQX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |