C13H16ClNOS — CID 95579036
(2R)-2-[(2-chlorophenyl)methylsulfanyl]-N-cyclopropylpropanamide (PubChem CID 95579036) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is (2R)-2-[(2-chlorophenyl)methylsulfanyl]-N-cyclopropylpropanamide.
| Compound Name | (2R)-2-[(2-chlorophenyl)methylsulfanyl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 95579036 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (2R)-2-[(2-chlorophenyl)methylsulfanyl]-N-cyclopropylpropanamide |
| SMILES | C[C@@H](SCc1ccccc1Cl)C(=O)NC1CC1 |
| InChI | InChI=1S/C13H16ClNOS/c1-9(13(16)15-11-6-7-11)17-8-10-4-2-3-5-12(10)14/h2-5,9,11H,6-8H2,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | YAGUBBIOLCRBMO-SECBINFHSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |