C15H22Cl2N2OS — CID 119478329
N-(4-aminocyclohexyl)-2-(2-chlorophenyl)sulfanylpropanamide;hydrochloride (PubChem CID 119478329) has the molecular formula C15H22Cl2N2OS and a molecular weight of 349.33 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(2-chlorophenyl)sulfanylpropanamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-(2-chlorophenyl)sulfanylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119478329 |
| Molecular Formula | C15H22Cl2N2OS |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(2-chlorophenyl)sulfanylpropanamide;hydrochloride |
| SMILES | CC(Sc1ccccc1Cl)C(=O)NC1CCC(N)CC1.Cl |
| InChI | InChI=1S/C15H21ClN2OS.ClH/c1-10(20-14-5-3-2-4-13(14)16)15(19)18-12-8-6-11(17)7-9-12;/h2-5,10-12H,6-9,17H2,1H3,(H,18,19);1H |
| InChIKey | NGUSVBXFJXZQHF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |