C12H13ClO2S — CID 103288004
2-[(2-chlorophenyl)methylsulfanyl]-2-cyclopropylacetic acid (PubChem CID 103288004) has the molecular formula C12H13ClO2S and a molecular weight of 256.75 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-2-cyclopropylacetic acid.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-2-cyclopropylacetic acid |
|---|---|
| PubChem CID | 103288004 |
| Molecular Formula | C12H13ClO2S |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-2-cyclopropylacetic acid |
| SMILES | O=C(O)C(SCc1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C12H13ClO2S/c13-10-4-2-1-3-9(10)7-16-11(12(14)15)8-5-6-8/h1-4,8,11H,5-7H2,(H,14,15) |
| InChIKey | HRPJLMPYRWYDTB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |