C9H12N2O2 — CID 106228611
3-(pent-1-yn-3-ylamino)pyrrolidine-2,5-dione (PubChem CID 106228611) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-(pent-1-yn-3-ylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(pent-1-yn-3-ylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106228611 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-(pent-1-yn-3-ylamino)pyrrolidine-2,5-dione |
| SMILES | C#CC(CC)NC1CC(=O)NC1=O |
| InChI | InChI=1S/C9H12N2O2/c1-3-6(4-2)10-7-5-8(12)11-9(7)13/h1,6-7,10H,4-5H2,2H3,(H,11,12,13) |
| InChIKey | FNJQIEYYACVTKU-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|