C7H10NO2S2Y- — CID 58713838
1-methyl-3-(1-sulfanylethylsulfanyl)pyrrolidine-2,5-dione;yttrium (PubChem CID 58713838) has the molecular formula C7H10NO2S2Y- and a molecular weight of 293.20 g/mol. Its IUPAC name is 1-methyl-3-(1-sulfanylethylsulfanyl)pyrrolidine-2,5-dione;yttrium.
| Compound Name | 1-methyl-3-(1-sulfanylethylsulfanyl)pyrrolidine-2,5-dione;yttrium |
|---|---|
| PubChem CID | 58713838 |
| Molecular Formula | C7H10NO2S2Y- |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.92 |
| IUPAC Name | 1-methyl-3-(1-sulfanylethylsulfanyl)pyrrolidine-2,5-dione;yttrium |
| SMILES | C[C-](S)SC1CC(=O)N(C)C1=O.[Y] |
| InChI | InChI=1S/C7H10NO2S2.Y/c1-4(11)12-5-3-6(9)8(2)7(5)10;/h5,11H,3H2,1-2H3;/q-1; |
| InChIKey | SRFXOLIHYAMXGE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|