C32H31N3O4S2 — CID 99129797
[(3R)-1-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]phenyl]-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate (PubChem CID 99129797) has the molecular formula C32H31N3O4S2 and a molecular weight of 585.75 g/mol. Its IUPAC name is [(3R)-1-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]phenyl]-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate.
| Compound Name | [(3R)-1-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]phenyl]-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 99129797 |
| Molecular Formula | C32H31N3O4S2 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | [(3R)-1-[4-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]phenyl]-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate |
| SMILES | COc1cccc(/C=C/C(=O)c2ccc(N3C(=O)C[C@@H](SC(=S)N4CCN(Cc5ccccc5)CC4)C3=O)cc2)c1 |
| InChI | InChI=1S/C32H31N3O4S2/c1-39-27-9-5-8-23(20-27)10-15-28(36)25-11-13-26(14-12-25)35-30(37)21-29(31(35)38)41-32(40)34-18-16-33(17-19-34)22-24-6-3-2-4-7-24/h2-15,20,29H,16-19,21-22H2,1H3/b15-10+/t29-/m1/s1 |
| InChIKey | UVEOANDNXIOWLA-BVEXFFHSSA-N |
| XLogP | 5.06 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|