C27H28N2O7S2 — CID 19057800
[2,5-dioxo-1-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-3-yl] morpholine-4-carbodithioate (PubChem CID 19057800) has the molecular formula C27H28N2O7S2 and a molecular weight of 556.66 g/mol. Its IUPAC name is [2,5-dioxo-1-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-3-yl] morpholine-4-carbodithioate.
| Compound Name | [2,5-dioxo-1-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-3-yl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 19057800 |
| Molecular Formula | C27H28N2O7S2 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | [2,5-dioxo-1-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-3-yl] morpholine-4-carbodithioate |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(N3C(=O)CC(SC(=S)N4CCOCC4)C3=O)cc2)c(OC)c1OC |
| InChI | InChI=1S/C27H28N2O7S2/c1-33-21-11-7-18(24(34-2)25(21)35-3)6-10-20(30)17-4-8-19(9-5-17)29-23(31)16-22(26(29)32)38-27(37)28-12-14-36-15-13-28/h4-11,22H,12-16H2,1-3H3/b10-6+ |
| InChIKey | FRIJRWSUVKGKNX-UXBLZVDNSA-N |
| XLogP | 3.59 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|