C26H31NO3 — CID 139259675
2-[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-[(4-tert-butylphenyl)methyl]butanal (PubChem CID 139259675) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-[(4-tert-butylphenyl)methyl]butanal.
| Compound Name | 2-[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-[(4-tert-butylphenyl)methyl]butanal |
|---|---|
| PubChem CID | 139259675 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 2-[(3R)-1-benzyl-2,5-dioxopyrrolidin-3-yl]-2-[(4-tert-butylphenyl)methyl]butanal |
| SMILES | CCC(C=O)(Cc1ccc(C(C)(C)C)cc1)[C@H]1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C26H31NO3/c1-5-26(18-28,16-19-11-13-21(14-12-19)25(2,3)4)22-15-23(29)27(24(22)30)17-20-9-7-6-8-10-20/h6-14,18,22H,5,15-17H2,1-4H3/t22-,26?/m0/s1 |
| InChIKey | OHCWRRRYJJBWKO-CHQVSRGASA-N |
| XLogP | 4.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|