C18H22F3NO3 — CID 139188973
(3S,4S)-1-benzyl-3-[(1R)-1-hydroxy-2,2-dimethylpropyl]-4-(trifluoromethyl)piperidine-2,6-dione (PubChem CID 139188973) has the molecular formula C18H22F3NO3 and a molecular weight of 357.37 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3-[(1R)-1-hydroxy-2,2-dimethylpropyl]-4-(trifluoromethyl)piperidine-2,6-dione.
| Compound Name | (3S,4S)-1-benzyl-3-[(1R)-1-hydroxy-2,2-dimethylpropyl]-4-(trifluoromethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 139188973 |
| Molecular Formula | C18H22F3NO3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (3S,4S)-1-benzyl-3-[(1R)-1-hydroxy-2,2-dimethylpropyl]-4-(trifluoromethyl)piperidine-2,6-dione |
| SMILES | CC(C)(C)[C@H](O)[C@H]1C(=O)N(Cc2ccccc2)C(=O)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C18H22F3NO3/c1-17(2,3)15(24)14-12(18(19,20)21)9-13(23)22(16(14)25)10-11-7-5-4-6-8-11/h4-8,12,14-15,24H,9-10H2,1-3H3/t12-,14-,15+/m0/s1 |
| InChIKey | YDOXGCSWROSWDU-AEGPPILISA-N |
| XLogP | 3.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|