About 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid
5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid (PubChem CID 61037053) has the molecular formula C13H11NO6
and a molecular weight of 277.23 g/mol. Its IUPAC name is 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid |
| PubChem CID | 61037053 |
| Molecular Formula | C13H11NO6 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid |
| SMILES | CC1CC(=O)N(c2cc(C(=O)O)cc(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C13H11NO6/c1-6-2-10(15)14(11(6)16)9-4-7(12(17)18)3-8(5-9)13(19)20/h3-6H,2H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | JZJSGTVJLJSTMZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid?
The IUPAC name of 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid (CID 61037053) is 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid?
The canonical SMILES for 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid is CC1CC(=O)N(c2cc(C(=O)O)cc(C(=O)O)c2)C1=O.
What is the InChIKey of 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid?
The InChIKey is JZJSGTVJLJSTMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO6/c1-6-2-10(15)14(11(6)16)9-4-7(12(17)18)3-8(5-9)13(19)20/h3-6H,2H2,1H3,(H,17,18)(H,19,20).
What are the key properties of 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid?
5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid has a molecular weight of 277.23 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 61037053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).