C11H11NO4S — CID 61037559
3-methyl-5-(3-methyl-2,5-dioxopyrrolidin-1-yl)thiophene-2-carboxylic acid (PubChem CID 61037559) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is 3-methyl-5-(3-methyl-2,5-dioxopyrrolidin-1-yl)thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-(3-methyl-2,5-dioxopyrrolidin-1-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61037559 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 3-methyl-5-(3-methyl-2,5-dioxopyrrolidin-1-yl)thiophene-2-carboxylic acid |
| SMILES | Cc1cc(N2C(=O)CC(C)C2=O)sc1C(=O)O |
| InChI | InChI=1S/C11H11NO4S/c1-5-4-8(17-9(5)11(15)16)12-7(13)3-6(2)10(12)14/h4,6H,3H2,1-2H3,(H,15,16) |
| InChIKey | KFBUPBSKEPXTPL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|