5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid

C11H11NO4S — CID 28930849

IUPAC5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid
SMILESCc1cc(N2C(=O)CCCC2=O)sc1C(=O)O
InChIInChI=1S/C11H11NO4S/c1-6-5-9(17-10(6)11(15)16)12-7(13)3-2-4-8(12)14/h5H,2-4H2,1H3,(H,15,16)
InChIKeyUUSYHLDSWWZVND-UHFFFAOYSA-N
MW253.28 g/mol
LogP1.80
Rot. Bonds2

About 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid

5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid (PubChem CID 28930849) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid.

Molecular Properties

Compound Name5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid
PubChem CID28930849
Molecular FormulaC11H11NO4S
Molecular Weight253.28 g/mol
Exact Mass253.04
IUPAC Name5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid
SMILESCc1cc(N2C(=O)CCCC2=O)sc1C(=O)O
InChIInChI=1S/C11H11NO4S/c1-6-5-9(17-10(6)11(15)16)12-7(13)3-2-4-8(12)14/h5H,2-4H2,1H3,(H,15,16)
InChIKeyUUSYHLDSWWZVND-UHFFFAOYSA-N
XLogP1.80
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.28
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid?
The IUPAC name of 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid (CID 28930849) is 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid.
What is the SMILES notation for 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid?
The canonical SMILES for 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid is Cc1cc(N2C(=O)CCCC2=O)sc1C(=O)O.
What is the InChIKey of 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid?
The InChIKey is UUSYHLDSWWZVND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4S/c1-6-5-9(17-10(6)11(15)16)12-7(13)3-2-4-8(12)14/h5H,2-4H2,1H3,(H,15,16).
What are the key properties of 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid?
5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid has a molecular weight of 253.28 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-dioxopiperidin-1-yl)-3-methylthiophene-2-carboxylic acid is sourced from PubChem (CID 28930849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).