C20H26N2O4 — CID 99811832
3-[(3R)-3-[methyl-[(4-methylcyclohexyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 99811832) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-[(3R)-3-[methyl-[(4-methylcyclohexyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 3-[(3R)-3-[methyl-[(4-methylcyclohexyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 99811832 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 3-[(3R)-3-[methyl-[(4-methylcyclohexyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | CC1CCC(CN(C)[C@@H]2CC(=O)N(c3cccc(C(=O)O)c3)C2=O)CC1 |
| InChI | InChI=1S/C20H26N2O4/c1-13-6-8-14(9-7-13)12-21(2)17-11-18(23)22(19(17)24)16-5-3-4-15(10-16)20(25)26/h3-5,10,13-14,17H,6-9,11-12H2,1-2H3,(H,25,26)/t13?,14?,17-/m1/s1 |
| InChIKey | FAQZCRDIHXHDQL-MQBCKMQZSA-N |
| XLogP | 2.77 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|