C19H13F3N2O6 — CID 43861018
5-[2,5-dioxo-3-[2-(trifluoromethyl)anilino]pyrrolidin-1-yl]benzene-1,3-dicarboxylic acid (PubChem CID 43861018) has the molecular formula C19H13F3N2O6 and a molecular weight of 422.32 g/mol. Its IUPAC name is 5-[2,5-dioxo-3-[2-(trifluoromethyl)anilino]pyrrolidin-1-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[2,5-dioxo-3-[2-(trifluoromethyl)anilino]pyrrolidin-1-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 43861018 |
| Molecular Formula | C19H13F3N2O6 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 5-[2,5-dioxo-3-[2-(trifluoromethyl)anilino]pyrrolidin-1-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2C(=O)CC(Nc3ccccc3C(F)(F)F)C2=O)c1 |
| InChI | InChI=1S/C19H13F3N2O6/c20-19(21,22)12-3-1-2-4-13(12)23-14-8-15(25)24(16(14)26)11-6-9(17(27)28)5-10(7-11)18(29)30/h1-7,14,23H,8H2,(H,27,28)(H,29,30) |
| InChIKey | OXTXVKWCWNTIMU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|