C18H12ClF3N2O4 — CID 43860705
4-[3-[4-chloro-2-(trifluoromethyl)anilino]-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 43860705) has the molecular formula C18H12ClF3N2O4 and a molecular weight of 412.75 g/mol. Its IUPAC name is 4-[3-[4-chloro-2-(trifluoromethyl)anilino]-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-[3-[4-chloro-2-(trifluoromethyl)anilino]-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 43860705 |
| Molecular Formula | C18H12ClF3N2O4 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 4-[3-[4-chloro-2-(trifluoromethyl)anilino]-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)CC(Nc3ccc(Cl)cc3C(F)(F)F)C2=O)cc1 |
| InChI | InChI=1S/C18H12ClF3N2O4/c19-10-3-6-13(12(7-10)18(20,21)22)23-14-8-15(25)24(16(14)26)11-4-1-9(2-5-11)17(27)28/h1-7,14,23H,8H2,(H,27,28) |
| InChIKey | AAAYYSPHBLKANQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|