C17H11Cl3N2O5 — CID 43860920
5-[2,5-dioxo-3-(2,4,5-trichloroanilino)pyrrolidin-1-yl]-2-hydroxybenzoic acid (PubChem CID 43860920) has the molecular formula C17H11Cl3N2O5 and a molecular weight of 429.64 g/mol. Its IUPAC name is 5-[2,5-dioxo-3-(2,4,5-trichloroanilino)pyrrolidin-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 5-[2,5-dioxo-3-(2,4,5-trichloroanilino)pyrrolidin-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 43860920 |
| Molecular Formula | C17H11Cl3N2O5 |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 5-[2,5-dioxo-3-(2,4,5-trichloroanilino)pyrrolidin-1-yl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)CC(Nc3cc(Cl)c(Cl)cc3Cl)C2=O)ccc1O |
| InChI | InChI=1S/C17H11Cl3N2O5/c18-9-4-11(20)12(5-10(9)19)21-13-6-15(24)22(16(13)25)7-1-2-14(23)8(3-7)17(26)27/h1-5,13,21,23H,6H2,(H,26,27) |
| InChIKey | MAZPTCWGJFHJCT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|