C18H13ClN2O7 — CID 43860997
5-[3-(4-chloro-2-hydroxyanilino)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid (PubChem CID 43860997) has the molecular formula C18H13ClN2O7 and a molecular weight of 404.76 g/mol. Its IUPAC name is 5-[3-(4-chloro-2-hydroxyanilino)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[3-(4-chloro-2-hydroxyanilino)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 43860997 |
| Molecular Formula | C18H13ClN2O7 |
| Molecular Weight | 404.76 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 5-[3-(4-chloro-2-hydroxyanilino)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2C(=O)CC(Nc3ccc(Cl)cc3O)C2=O)c1 |
| InChI | InChI=1S/C18H13ClN2O7/c19-10-1-2-12(14(22)6-10)20-13-7-15(23)21(16(13)24)11-4-8(17(25)26)3-9(5-11)18(27)28/h1-6,13,20,22H,7H2,(H,25,26)(H,27,28) |
| InChIKey | KRWXTJGAPPXEBS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|