C18H13N3O8 — CID 43861033
5-[3-(4-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid (PubChem CID 43861033) has the molecular formula C18H13N3O8 and a molecular weight of 399.32 g/mol. Its IUPAC name is 5-[3-(4-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[3-(4-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 43861033 |
| Molecular Formula | C18H13N3O8 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 5-[3-(4-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2C(=O)CC(Nc3ccc([N+](=O)[O-])cc3)C2=O)c1 |
| InChI | InChI=1S/C18H13N3O8/c22-15-8-14(19-11-1-3-12(4-2-11)21(28)29)16(23)20(15)13-6-9(17(24)25)5-10(7-13)18(26)27/h1-7,14,19H,8H2,(H,24,25)(H,26,27) |
| InChIKey | FFTJOOOXXLRGAK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 167.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|