C12H7Cl2F3N2O3 — CID 20537585
N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 20537585) has the molecular formula C12H7Cl2F3N2O3 and a molecular weight of 355.10 g/mol. Its IUPAC name is N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 20537585 |
| Molecular Formula | C12H7Cl2F3N2O3 |
| Molecular Weight | 355.10 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1CC(NC(=O)C(F)(F)F)C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H7Cl2F3N2O3/c13-5-1-6(14)3-7(2-5)19-9(20)4-8(10(19)21)18-11(22)12(15,16)17/h1-3,8H,4H2,(H,18,22) |
| InChIKey | CGAGCYXQPRQCOX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.10 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|