C14H14Cl2N2O5 — CID 20537583
2-methoxyethyl N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 20537583) has the molecular formula C14H14Cl2N2O5 and a molecular weight of 361.18 g/mol. Its IUPAC name is 2-methoxyethyl N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 20537583 |
| Molecular Formula | C14H14Cl2N2O5 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 2-methoxyethyl N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | COCCOC(=O)NC1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C14H14Cl2N2O5/c1-22-2-3-23-14(21)17-11-7-12(19)18(13(11)20)10-5-8(15)4-9(16)6-10/h4-6,11H,2-3,7H2,1H3,(H,17,21) |
| InChIKey | WPYFIRKNXXGOAF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|