C21H17Cl2N3O7 — CID 97047056
dimethyl 5-[(3S)-3-[2-(2,4-dichlorobenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate (PubChem CID 97047056) has the molecular formula C21H17Cl2N3O7 and a molecular weight of 494.29 g/mol. Its IUPAC name is dimethyl 5-[(3S)-3-[2-(2,4-dichlorobenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(3S)-3-[2-(2,4-dichlorobenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 97047056 |
| Molecular Formula | C21H17Cl2N3O7 |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | dimethyl 5-[(3S)-3-[2-(2,4-dichlorobenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(N2C(=O)C[C@H](NNC(=O)c3ccc(Cl)cc3Cl)C2=O)c1 |
| InChI | InChI=1S/C21H17Cl2N3O7/c1-32-20(30)10-5-11(21(31)33-2)7-13(6-10)26-17(27)9-16(19(26)29)24-25-18(28)14-4-3-12(22)8-15(14)23/h3-8,16,24H,9H2,1-2H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | NIHMQJGLYPXZLO-INIZCTEOSA-N |
| XLogP | 2.13 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|