C17H13ClN4O5 — CID 5443187
N'-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-nitrobenzohydrazide (PubChem CID 5443187) has the molecular formula C17H13ClN4O5 and a molecular weight of 388.77 g/mol. Its IUPAC name is N'-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-nitrobenzohydrazide.
| Compound Name | N'-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 5443187 |
| Molecular Formula | C17H13ClN4O5 |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N'-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-nitrobenzohydrazide |
| SMILES | O=C(NN[C@H]1CC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13ClN4O5/c18-10-5-7-11(8-6-10)21-15(23)9-13(17(21)25)19-20-16(24)12-3-1-2-4-14(12)22(26)27/h1-8,13,19H,9H2,(H,20,24)/t13-/m0/s1 |
| InChIKey | IAECATRMWBBERI-ZDUSSCGKSA-N |
| XLogP | 1.81 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|