C21H18BrN3O7 — CID 1265716
dimethyl 5-[(3R)-3-[2-(2-bromobenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate (PubChem CID 1265716) has the molecular formula C21H18BrN3O7 and a molecular weight of 504.29 g/mol. Its IUPAC name is dimethyl 5-[(3R)-3-[2-(2-bromobenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(3R)-3-[2-(2-bromobenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 1265716 |
| Molecular Formula | C21H18BrN3O7 |
| Molecular Weight | 504.29 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | dimethyl 5-[(3R)-3-[2-(2-bromobenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(N2C(=O)C[C@@H](NNC(=O)c3ccccc3Br)C2=O)c1 |
| InChI | InChI=1S/C21H18BrN3O7/c1-31-20(29)11-7-12(21(30)32-2)9-13(8-11)25-17(26)10-16(19(25)28)23-24-18(27)14-5-3-4-6-15(14)22/h3-9,16,23H,10H2,1-2H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | YHBURLVXPOKIJS-MRXNPFEDSA-N |
| XLogP | 1.59 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|