C13H11BrCl2N2O4 — CID 20537574
2-bromoethyl N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 20537574) has the molecular formula C13H11BrCl2N2O4 and a molecular weight of 410.05 g/mol. Its IUPAC name is 2-bromoethyl N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | 2-bromoethyl N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 20537574 |
| Molecular Formula | C13H11BrCl2N2O4 |
| Molecular Weight | 410.05 g/mol |
| Exact Mass | 407.93 |
| IUPAC Name | 2-bromoethyl N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | O=C(NC1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1=O)OCCBr |
| InChI | InChI=1S/C13H11BrCl2N2O4/c14-1-2-22-13(21)17-10-6-11(19)18(12(10)20)9-4-7(15)3-8(16)5-9/h3-5,10H,1-2,6H2,(H,17,21) |
| InChIKey | YVVNUIQTZZJIHD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.05 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|