C18H13BrCl2N2O3S — CID 2853313
N-(4-bromophenyl)-2-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide (PubChem CID 2853313) has the molecular formula C18H13BrCl2N2O3S and a molecular weight of 488.19 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide.
| Compound Name | N-(4-bromophenyl)-2-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2853313 |
| Molecular Formula | C18H13BrCl2N2O3S |
| Molecular Weight | 488.19 g/mol |
| Exact Mass | 485.92 |
| IUPAC Name | N-(4-bromophenyl)-2-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
| SMILES | O=C(CSC1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H13BrCl2N2O3S/c19-10-1-3-13(4-2-10)22-16(24)9-27-15-8-17(25)23(18(15)26)14-6-11(20)5-12(21)7-14/h1-7,15H,8-9H2,(H,22,24) |
| InChIKey | QUYWYSLLLHPFJC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.19 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|