C20H19ClN2O3S — CID 2958653
N-(4-chlorophenyl)-2-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide (PubChem CID 2958653) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2958653 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylacetamide |
| SMILES | Cc1cc(C)cc(N2C(=O)CC(SCC(=O)Nc3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C20H19ClN2O3S/c1-12-7-13(2)9-16(8-12)23-19(25)10-17(20(23)26)27-11-18(24)22-15-5-3-14(21)4-6-15/h3-9,17H,10-11H2,1-2H3,(H,22,24) |
| InChIKey | DRPOCUOIVJMZKF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|