C23H22N2O7S — CID 4859519
dimethyl 5-[3-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate (PubChem CID 4859519) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is dimethyl 5-[3-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4859519 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | dimethyl 5-[3-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(N2C(=O)CC(SCC(=O)Nc3ccc(C)cc3)C2=O)c1 |
| InChI | InChI=1S/C23H22N2O7S/c1-13-4-6-16(7-5-13)24-19(26)12-33-18-11-20(27)25(21(18)28)17-9-14(22(29)31-2)8-15(10-17)23(30)32-3/h4-10,18H,11-12H2,1-3H3,(H,24,26) |
| InChIKey | FTHPHYHGOFUPBX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|