C22H23N3O4 — CID 51509723
(3S)-1-(4-butylphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]pyrrolidine-2,5-dione (PubChem CID 51509723) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (3S)-1-(4-butylphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-butylphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51509723 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (3S)-1-(4-butylphenyl)-3-[(3-oxo-4H-1,4-benzoxazin-6-yl)amino]pyrrolidine-2,5-dione |
| SMILES | CCCCc1ccc(N2C(=O)C[C@H](Nc3ccc4c(c3)NC(=O)CO4)C2=O)cc1 |
| InChI | InChI=1S/C22H23N3O4/c1-2-3-4-14-5-8-16(9-6-14)25-21(27)12-18(22(25)28)23-15-7-10-19-17(11-15)24-20(26)13-29-19/h5-11,18,23H,2-4,12-13H2,1H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | OCNKLQKCPAPXMK-SFHVURJKSA-N |
| XLogP | 3.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|