C20H22N2O3S — CID 51659053
(3S)-3-(4-methylsulfanylanilino)-1-(4-propoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 51659053) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is (3S)-3-(4-methylsulfanylanilino)-1-(4-propoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(4-methylsulfanylanilino)-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51659053 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (3S)-3-(4-methylsulfanylanilino)-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCOc1ccc(N2C(=O)C[C@H](Nc3ccc(SC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-3-12-25-16-8-6-15(7-9-16)22-19(23)13-18(20(22)24)21-14-4-10-17(26-2)11-5-14/h4-11,18,21H,3,12-13H2,1-2H3/t18-/m0/s1 |
| InChIKey | KAACUKXNDHMWNM-SFHVURJKSA-N |
| XLogP | 3.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|