C16H22N2O4 — CID 3720152
3-(3-hydroxypropylamino)-1-(4-propoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 3720152) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-(3-hydroxypropylamino)-1-(4-propoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(3-hydroxypropylamino)-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 3720152 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-(3-hydroxypropylamino)-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCOc1ccc(N2C(=O)CC(NCCCO)C2=O)cc1 |
| InChI | InChI=1S/C16H22N2O4/c1-2-10-22-13-6-4-12(5-7-13)18-15(20)11-14(16(18)21)17-8-3-9-19/h4-7,14,17,19H,2-3,8-11H2,1H3 |
| InChIKey | VQBCGGUTKXQHKH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|