C19H18N2O5 — CID 167835116
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-1-(4-hydroxyphenyl)pyrrolidine-2,5-dione (PubChem CID 167835116) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-1-(4-hydroxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-1-(4-hydroxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167835116 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-1-(4-hydroxyphenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2ccc3c(c2)OCCCO3)C(=O)N1c1ccc(O)cc1 |
| InChI | InChI=1S/C19H18N2O5/c22-14-5-3-13(4-6-14)21-18(23)11-15(19(21)24)20-12-2-7-16-17(10-12)26-9-1-8-25-16/h2-7,10,15,20,22H,1,8-9,11H2 |
| InChIKey | PEHHCLCMDWWEMM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|