C21H23N3O2 — CID 94595712
(3S)-3-(2,3-dihydro-1H-inden-5-ylamino)-1-[4-(dimethylamino)phenyl]pyrrolidine-2,5-dione (PubChem CID 94595712) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3S)-3-(2,3-dihydro-1H-inden-5-ylamino)-1-[4-(dimethylamino)phenyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(2,3-dihydro-1H-inden-5-ylamino)-1-[4-(dimethylamino)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 94595712 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (3S)-3-(2,3-dihydro-1H-inden-5-ylamino)-1-[4-(dimethylamino)phenyl]pyrrolidine-2,5-dione |
| SMILES | CN(C)c1ccc(N2C(=O)C[C@H](Nc3ccc4c(c3)CCC4)C2=O)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-23(2)17-8-10-18(11-9-17)24-20(25)13-19(21(24)26)22-16-7-6-14-4-3-5-15(14)12-16/h6-12,19,22H,3-5,13H2,1-2H3/t19-/m0/s1 |
| InChIKey | LKIXONICTRFUPK-IBGZPJMESA-N |
| XLogP | 2.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|