C18H15ClN4O2S — CID 1213341
(3R)-3-[2-(1,3-benzothiazol-2-yl)hydrazinyl]-1-(4-chloro-2-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 1213341) has the molecular formula C18H15ClN4O2S and a molecular weight of 386.86 g/mol. Its IUPAC name is (3R)-3-[2-(1,3-benzothiazol-2-yl)hydrazinyl]-1-(4-chloro-2-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[2-(1,3-benzothiazol-2-yl)hydrazinyl]-1-(4-chloro-2-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1213341 |
| Molecular Formula | C18H15ClN4O2S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (3R)-3-[2-(1,3-benzothiazol-2-yl)hydrazinyl]-1-(4-chloro-2-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1cc(Cl)ccc1N1C(=O)C[C@@H](NNc2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C18H15ClN4O2S/c1-10-8-11(19)6-7-14(10)23-16(24)9-13(17(23)25)21-22-18-20-12-4-2-3-5-15(12)26-18/h2-8,13,21H,9H2,1H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | PLAYBMWYNWAIPR-CYBMUJFWSA-N |
| XLogP | 3.51 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|