C16H9BrClF2NO2S — CID 2809197
1-(4-bromo-2,5-difluorophenyl)-3-(4-chlorophenyl)sulfanylpyrrolidine-2,5-dione (PubChem CID 2809197) has the molecular formula C16H9BrClF2NO2S and a molecular weight of 432.67 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-3-(4-chlorophenyl)sulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-3-(4-chlorophenyl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2809197 |
| Molecular Formula | C16H9BrClF2NO2S |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 430.92 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-3-(4-chlorophenyl)sulfanylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(Sc2ccc(Cl)cc2)C(=O)N1c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C16H9BrClF2NO2S/c17-10-5-12(20)13(6-11(10)19)21-15(22)7-14(16(21)23)24-9-3-1-8(18)2-4-9/h1-6,14H,7H2 |
| InChIKey | DWZHXLZNELDFEI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|