C26H20N2O7S — CID 23100475
2-[[4-[1-(4-methoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 23100475) has the molecular formula C26H20N2O7S and a molecular weight of 504.52 g/mol. Its IUPAC name is 2-[[4-[1-(4-methoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-[1-(4-methoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 23100475 |
| Molecular Formula | C26H20N2O7S |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-[[4-[1-(4-methoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)c4ccccc4C(=O)O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H20N2O7S/c1-35-26(34)15-6-10-17(11-7-15)28-22(29)14-21(24(28)31)36-18-12-8-16(9-13-18)27-23(30)19-4-2-3-5-20(19)25(32)33/h2-13,21H,14H2,1H3,(H,27,30)(H,32,33) |
| InChIKey | OLIVIACPQAYYMB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|