C26H19N3O8S — CID 21168536
4-[[4-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid (PubChem CID 21168536) has the molecular formula C26H19N3O8S and a molecular weight of 533.52 g/mol. Its IUPAC name is 4-[[4-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[[4-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 21168536 |
| Molecular Formula | C26H19N3O8S |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 4-[[4-[1-(4-carbamoylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid |
| SMILES | NC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)c4ccc(C(=O)O)cc4C(=O)O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H19N3O8S/c27-22(31)13-1-6-16(7-2-13)29-21(30)12-20(24(29)33)38-17-8-4-15(5-9-17)28-23(32)18-10-3-14(25(34)35)11-19(18)26(36)37/h1-11,20H,12H2,(H2,27,31)(H,28,32)(H,34,35)(H,36,37) |
| InChIKey | ZCXVCYISLRNJOF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|