C22H23IN2O3S — CID 21167600
N-[4-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3,3-dimethylbutanamide (PubChem CID 21167600) has the molecular formula C22H23IN2O3S and a molecular weight of 522.41 g/mol. Its IUPAC name is N-[4-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 21167600 |
| Molecular Formula | C22H23IN2O3S |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 522.05 |
| IUPAC Name | N-[4-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc(SC2CC(=O)N(c3ccc(I)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H23IN2O3S/c1-22(2,3)13-19(26)24-15-6-10-17(11-7-15)29-18-12-20(27)25(21(18)28)16-8-4-14(23)5-9-16/h4-11,18H,12-13H2,1-3H3,(H,24,26) |
| InChIKey | NMQNJOVCIYDJJO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|