C29H23N5O3S — CID 99129536
1-[3-[(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea (PubChem CID 99129536) has the molecular formula C29H23N5O3S and a molecular weight of 521.60 g/mol. Its IUPAC name is 1-[3-[(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea.
| Compound Name | 1-[3-[(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 99129536 |
| Molecular Formula | C29H23N5O3S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 1-[3-[(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(S[C@@H]2CC(=O)N(c3ccc(/N=N/c4ccccc4)cc3)C2=O)c1 |
| InChI | InChI=1S/C29H23N5O3S/c35-27-19-26(38-25-13-7-12-23(18-25)31-29(37)30-20-8-3-1-4-9-20)28(36)34(27)24-16-14-22(15-17-24)33-32-21-10-5-2-6-11-21/h1-18,26H,19H2,(H2,30,31,37)/b33-32+/t26-/m1/s1 |
| InChIKey | INOQEQRDGUIJPF-XKHIVHIHSA-N |
| XLogP | 7.17 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|