C25H18FN3O3S — CID 19058369
2-fluoro-N-[3-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]benzamide (PubChem CID 19058369) has the molecular formula C25H18FN3O3S and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-fluoro-N-[3-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 2-fluoro-N-[3-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 19058369 |
| Molecular Formula | C25H18FN3O3S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 2-fluoro-N-[3-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1cccc(SC2CC(=O)N(c3ccc4cc[nH]c4c3)C2=O)c1)c1ccccc1F |
| InChI | InChI=1S/C25H18FN3O3S/c26-20-7-2-1-6-19(20)24(31)28-16-4-3-5-18(12-16)33-22-14-23(30)29(25(22)32)17-9-8-15-10-11-27-21(15)13-17/h1-13,22,27H,14H2,(H,28,31) |
| InChIKey | BKWILXAFGVVDHL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|