C27H23N3O5S — CID 19058383
N-[3-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2,6-dimethoxybenzamide (PubChem CID 19058383) has the molecular formula C27H23N3O5S and a molecular weight of 501.56 g/mol. Its IUPAC name is N-[3-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[3-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 19058383 |
| Molecular Formula | C27H23N3O5S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | N-[3-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1cccc(SC2CC(=O)N(c3ccc4cc[nH]c4c3)C2=O)c1 |
| InChI | InChI=1S/C27H23N3O5S/c1-34-21-7-4-8-22(35-2)25(21)26(32)29-17-5-3-6-19(13-17)36-23-15-24(31)30(27(23)33)18-10-9-16-11-12-28-20(16)14-18/h3-14,23,28H,15H2,1-2H3,(H,29,32) |
| InChIKey | VZEZCCXGXAOUHZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|