C32H21BrCl2FN3O4S — CID 19057598
N-[(Z)-1-(4-bromophenyl)-3-[3-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide (PubChem CID 19057598) has the molecular formula C32H21BrCl2FN3O4S and a molecular weight of 713.41 g/mol. Its IUPAC name is N-[(Z)-1-(4-bromophenyl)-3-[3-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide.
| Compound Name | N-[(Z)-1-(4-bromophenyl)-3-[3-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 19057598 |
| Molecular Formula | C32H21BrCl2FN3O4S |
| Molecular Weight | 713.41 g/mol |
| Exact Mass | 710.98 |
| IUPAC Name | N-[(Z)-1-(4-bromophenyl)-3-[3-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide |
| SMILES | O=C(Nc1cccc(SC2CC(=O)N(c3cc(Cl)cc(Cl)c3)C2=O)c1)/C(=C/c1ccc(Br)cc1)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C32H21BrCl2FN3O4S/c33-19-10-8-18(9-11-19)12-27(38-30(41)25-6-1-2-7-26(25)36)31(42)37-22-4-3-5-24(16-22)44-28-17-29(40)39(32(28)43)23-14-20(34)13-21(35)15-23/h1-16,28H,17H2,(H,37,42)(H,38,41)/b27-12- |
| InChIKey | MWKZLFYNIRAJIA-PPDIBHTLSA-N |
| XLogP | 7.73 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.41 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|