C23H23ClN2O3S — CID 5263490
3-[2-(azepane-1-carbonyl)phenyl]sulfanyl-1-(4-chlorophenyl)pyrrolidine-2,5-dione (PubChem CID 5263490) has the molecular formula C23H23ClN2O3S and a molecular weight of 442.97 g/mol. Its IUPAC name is 3-[2-(azepane-1-carbonyl)phenyl]sulfanyl-1-(4-chlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[2-(azepane-1-carbonyl)phenyl]sulfanyl-1-(4-chlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5263490 |
| Molecular Formula | C23H23ClN2O3S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 3-[2-(azepane-1-carbonyl)phenyl]sulfanyl-1-(4-chlorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C(c1ccccc1SC1CC(=O)N(c2ccc(Cl)cc2)C1=O)N1CCCCCC1 |
| InChI | InChI=1S/C23H23ClN2O3S/c24-16-9-11-17(12-10-16)26-21(27)15-20(23(26)29)30-19-8-4-3-7-18(19)22(28)25-13-5-1-2-6-14-25/h3-4,7-12,20H,1-2,5-6,13-15H2 |
| InChIKey | JPHCPOJYHPGKQD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|