C24H16ClNO5S — CID 27349963
(4-formylphenyl) 2-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate (PubChem CID 27349963) has the molecular formula C24H16ClNO5S and a molecular weight of 465.91 g/mol. Its IUPAC name is (4-formylphenyl) 2-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate.
| Compound Name | (4-formylphenyl) 2-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 27349963 |
| Molecular Formula | C24H16ClNO5S |
| Molecular Weight | 465.91 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | (4-formylphenyl) 2-[(3S)-1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate |
| SMILES | O=Cc1ccc(OC(=O)c2ccccc2S[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H16ClNO5S/c25-16-7-9-17(10-8-16)26-22(28)13-21(23(26)29)32-20-4-2-1-3-19(20)24(30)31-18-11-5-15(14-27)6-12-18/h1-12,14,21H,13H2/t21-/m0/s1 |
| InChIKey | QPUYACJKUNKYHT-NRFANRHFSA-N |
| XLogP | 4.80 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.91 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|