C27H24N2O6S — CID 23100487
[2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23100487) has the molecular formula C27H24N2O6S and a molecular weight of 504.56 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23100487 |
| Molecular Formula | C27H24N2O6S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-[3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(Sc4ccc(N)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H24N2O6S/c1-2-34-21-11-5-17(6-12-21)23(30)16-35-27(33)18-3-9-20(10-4-18)29-25(31)15-24(26(29)32)36-22-13-7-19(28)8-14-22/h3-14,24H,2,15-16,28H2,1H3 |
| InChIKey | WQFLCVUCTCMGJB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|